C11H10N6S — CID 113354522
N-[(2-phenyltriazol-4-yl)methyl]-1,3,4-thiadiazol-2-amine (PubChem CID 113354522) has the molecular formula C11H10N6S and a molecular weight of 258.31 g/mol. Its IUPAC name is N-[(2-phenyltriazol-4-yl)methyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | N-[(2-phenyltriazol-4-yl)methyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 113354522 |
| Molecular Formula | C11H10N6S |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | N-[(2-phenyltriazol-4-yl)methyl]-1,3,4-thiadiazol-2-amine |
| SMILES | c1ccc(-n2ncc(CNc3nncs3)n2)cc1 |
| InChI | InChI=1S/C11H10N6S/c1-2-4-10(5-3-1)17-14-7-9(16-17)6-12-11-15-13-8-18-11/h1-5,7-8H,6H2,(H,12,15) |
| InChIKey | DOXJITUQENFCRN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |