C15H17NOS — CID 113355448
(1S)-1-(5-benzylsulfanyl-2-pyridinyl)propan-1-ol (PubChem CID 113355448) has the molecular formula C15H17NOS and a molecular weight of 259.37 g/mol. Its IUPAC name is (1S)-1-(5-benzylsulfanyl-2-pyridinyl)propan-1-ol.
| Compound Name | (1S)-1-(5-benzylsulfanyl-2-pyridinyl)propan-1-ol |
|---|---|
| PubChem CID | 113355448 |
| Molecular Formula | C15H17NOS |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | (1S)-1-(5-benzylsulfanyl-2-pyridinyl)propan-1-ol |
| SMILES | CC[C@H](O)c1ccc(SCc2ccccc2)cn1 |
| InChI | InChI=1S/C15H17NOS/c1-2-15(17)14-9-8-13(10-16-14)18-11-12-6-4-3-5-7-12/h3-10,15,17H,2,11H2,1H3/t15-/m0/s1 |
| InChIKey | RLRKXQCQLBUEPZ-HNNXBMFYSA-N |
| XLogP | 3.82 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |