C14H23NO2S — CID 113357920
3-[[(2-ethyl-2-methylsulfanylbutyl)amino]methyl]benzene-1,2-diol (PubChem CID 113357920) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is 3-[[(2-ethyl-2-methylsulfanylbutyl)amino]methyl]benzene-1,2-diol.
| Compound Name | 3-[[(2-ethyl-2-methylsulfanylbutyl)amino]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 113357920 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 3-[[(2-ethyl-2-methylsulfanylbutyl)amino]methyl]benzene-1,2-diol |
| SMILES | CCC(CC)(CNCc1cccc(O)c1O)SC |
| InChI | InChI=1S/C14H23NO2S/c1-4-14(5-2,18-3)10-15-9-11-7-6-8-12(16)13(11)17/h6-8,15-17H,4-5,9-10H2,1-3H3 |
| InChIKey | NPGQAJCARAEJIO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|