C15H23F2NOS — CID 103702078
N-[[2-(difluoromethoxy)phenyl]methyl]-2-ethyl-2-methylsulfanylbutan-1-amine (PubChem CID 103702078) has the molecular formula C15H23F2NOS and a molecular weight of 303.42 g/mol. Its IUPAC name is N-[[2-(difluoromethoxy)phenyl]methyl]-2-ethyl-2-methylsulfanylbutan-1-amine.
| Compound Name | N-[[2-(difluoromethoxy)phenyl]methyl]-2-ethyl-2-methylsulfanylbutan-1-amine |
|---|---|
| PubChem CID | 103702078 |
| Molecular Formula | C15H23F2NOS |
| Molecular Weight | 303.42 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | N-[[2-(difluoromethoxy)phenyl]methyl]-2-ethyl-2-methylsulfanylbutan-1-amine |
| SMILES | CCC(CC)(CNCc1ccccc1OC(F)F)SC |
| InChI | InChI=1S/C15H23F2NOS/c1-4-15(5-2,20-3)11-18-10-12-8-6-7-9-13(12)19-14(16)17/h6-9,14,18H,4-5,10-11H2,1-3H3 |
| InChIKey | ZYLCPULEXUDDBC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |