C13H22N2O2S — CID 113359768
ethyl 2-(2-thia-4-azaspiro[5.5]undec-3-en-3-ylamino)acetate (PubChem CID 113359768) has the molecular formula C13H22N2O2S and a molecular weight of 270.40 g/mol. Its IUPAC name is ethyl 2-(2-thia-4-azaspiro[5.5]undec-3-en-3-ylamino)acetate.
| Compound Name | ethyl 2-(2-thia-4-azaspiro[5.5]undec-3-en-3-ylamino)acetate |
|---|---|
| PubChem CID | 113359768 |
| Molecular Formula | C13H22N2O2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | ethyl 2-(2-thia-4-azaspiro[5.5]undec-3-en-3-ylamino)acetate |
| SMILES | CCOC(=O)CNC1=NCC2(CCCCC2)CS1 |
| InChI | InChI=1S/C13H22N2O2S/c1-2-17-11(16)8-14-12-15-9-13(10-18-12)6-4-3-5-7-13/h2-10H2,1H3,(H,14,15) |
| InChIKey | MFTJYRSGGOUDLU-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |