C16H26F2N2O2 — CID 11336061
2-amino-2-(difluoromethyl)-5-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]pentanoic acid (PubChem CID 11336061) has the molecular formula C16H26F2N2O2 and a molecular weight of 316.39 g/mol. Its IUPAC name is 2-amino-2-(difluoromethyl)-5-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]pentanoic acid.
| Compound Name | 2-amino-2-(difluoromethyl)-5-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]pentanoic acid |
|---|---|
| PubChem CID | 11336061 |
| Molecular Formula | C16H26F2N2O2 |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 2-amino-2-(difluoromethyl)-5-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]pentanoic acid |
| SMILES | CC12CCC(C/C1=N\CCCC(N)(C(=O)O)C(F)F)C2(C)C |
| InChI | InChI=1S/C16H26F2N2O2/c1-14(2)10-5-7-15(14,3)11(9-10)20-8-4-6-16(19,12(17)18)13(21)22/h10,12H,4-9,19H2,1-3H3,(H,21,22)/b20-11+ |
| InChIKey | IYMZQQRMIJFMBX-RGVLZGJSSA-N |
| XLogP | 3.10 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|