C12H13Cl2N3O — CID 113360918
5,6-dichloro-2-[2-(oxolan-2-yl)ethyl]-1H-imidazo[4,5-b]pyridine (PubChem CID 113360918) has the molecular formula C12H13Cl2N3O and a molecular weight of 286.16 g/mol. Its IUPAC name is 5,6-dichloro-2-[2-(oxolan-2-yl)ethyl]-1H-imidazo[4,5-b]pyridine.
| Compound Name | 5,6-dichloro-2-[2-(oxolan-2-yl)ethyl]-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 113360918 |
| Molecular Formula | C12H13Cl2N3O |
| Molecular Weight | 286.16 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 5,6-dichloro-2-[2-(oxolan-2-yl)ethyl]-1H-imidazo[4,5-b]pyridine |
| SMILES | Clc1cc2[nH]c(CCC3CCCO3)nc2nc1Cl |
| InChI | InChI=1S/C12H13Cl2N3O/c13-8-6-9-12(17-11(8)14)16-10(15-9)4-3-7-2-1-5-18-7/h6-7H,1-5H2,(H,15,16,17) |
| InChIKey | ZMVHSVUZHUFTMR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.16 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|