C11H10F3N3O — CID 113363214
4-amino-5-ethyl-2-(3,4,5-trifluorophenyl)-1H-pyrazol-3-one (PubChem CID 113363214) has the molecular formula C11H10F3N3O and a molecular weight of 257.21 g/mol. Its IUPAC name is 4-amino-5-ethyl-2-(3,4,5-trifluorophenyl)-1H-pyrazol-3-one.
| Compound Name | 4-amino-5-ethyl-2-(3,4,5-trifluorophenyl)-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 113363214 |
| Molecular Formula | C11H10F3N3O |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 4-amino-5-ethyl-2-(3,4,5-trifluorophenyl)-1H-pyrazol-3-one |
| SMILES | CCc1[nH]n(-c2cc(F)c(F)c(F)c2)c(=O)c1N |
| InChI | InChI=1S/C11H10F3N3O/c1-2-8-10(15)11(18)17(16-8)5-3-6(12)9(14)7(13)4-5/h3-4,16H,2,15H2,1H3 |
| InChIKey | VJZVACNFRGOEMC-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 63.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|