C17H30O4Si — CID 11336364
trans-methyl (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-2-methyl-6-oxocyclohexane-1-carboxylate (PubChem CID 11336364) has the molecular formula C17H30O4Si and a molecular weight of 326.51 g/mol. Its IUPAC name is trans-methyl (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-2-methyl-6-oxocyclohexane-1-carboxylate.
| Compound Name | trans-methyl (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-2-methyl-6-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 11336364 |
| Molecular Formula | C17H30O4Si |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | trans-methyl (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-2-methyl-6-oxocyclohexane-1-carboxylate |
| SMILES | C=C[C@@]1(C)C(C(=O)OC)C(=O)CC[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H30O4Si/c1-9-17(5)13(21-22(7,8)16(2,3)4)11-10-12(18)14(17)15(19)20-6/h9,13-14H,1,10-11H2,2-8H3/t13-,14?,17+/m0/s1 |
| InChIKey | HMDNDESAMKMITC-BHVXPOTESA-N |
| XLogP | 3.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|