About [3-(methylamino)-3-oxopropyl] 3-amino-2-bromobenzoate
[3-(methylamino)-3-oxopropyl] 3-amino-2-bromobenzoate (PubChem CID 113367175) has the molecular formula C11H13BrN2O3
and a molecular weight of 301.14 g/mol. Its IUPAC name is [3-(methylamino)-3-oxopropyl] 3-amino-2-bromobenzoate.
Molecular Properties
| Compound Name | [3-(methylamino)-3-oxopropyl] 3-amino-2-bromobenzoate |
| PubChem CID | 113367175 |
| Molecular Formula | C11H13BrN2O3 |
| Molecular Weight | 301.14 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | [3-(methylamino)-3-oxopropyl] 3-amino-2-bromobenzoate |
| SMILES | CNC(=O)CCOC(=O)c1cccc(N)c1Br |
| InChI | InChI=1S/C11H13BrN2O3/c1-14-9(15)5-6-17-11(16)7-3-2-4-8(13)10(7)12/h2-4H,5-6,13H2,1H3,(H,14,15) |
| InChIKey | YUJHEDRGCSFOIH-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.14 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [3-(methylamino)-3-oxopropyl] 3-amino-2-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(methylamino)-3-oxopropyl] 3-amino-2-bromobenzoate?
The IUPAC name of [3-(methylamino)-3-oxopropyl] 3-amino-2-bromobenzoate (CID 113367175) is [3-(methylamino)-3-oxopropyl] 3-amino-2-bromobenzoate.
What is the SMILES notation for [3-(methylamino)-3-oxopropyl] 3-amino-2-bromobenzoate?
The canonical SMILES for [3-(methylamino)-3-oxopropyl] 3-amino-2-bromobenzoate is CNC(=O)CCOC(=O)c1cccc(N)c1Br.
What is the InChIKey of [3-(methylamino)-3-oxopropyl] 3-amino-2-bromobenzoate?
The InChIKey is YUJHEDRGCSFOIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BrN2O3/c1-14-9(15)5-6-17-11(16)7-3-2-4-8(13)10(7)12/h2-4H,5-6,13H2,1H3,(H,14,15).
What are the key properties of [3-(methylamino)-3-oxopropyl] 3-amino-2-bromobenzoate?
[3-(methylamino)-3-oxopropyl] 3-amino-2-bromobenzoate has a molecular weight of 301.14 g/mol, XLogP of 1.32, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(methylamino)-3-oxopropyl] 3-amino-2-bromobenzoate is sourced from PubChem (CID 113367175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).