About cyclopropylmethoxymethyl 3-amino-2-bromobenzoate
cyclopropylmethoxymethyl 3-amino-2-bromobenzoate (PubChem CID 106930497) has the molecular formula C12H14BrNO3
and a molecular weight of 300.15 g/mol. Its IUPAC name is cyclopropylmethoxymethyl 3-amino-2-bromobenzoate.
Molecular Properties
| Compound Name | cyclopropylmethoxymethyl 3-amino-2-bromobenzoate |
| PubChem CID | 106930497 |
| Molecular Formula | C12H14BrNO3 |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | cyclopropylmethoxymethyl 3-amino-2-bromobenzoate |
| SMILES | Nc1cccc(C(=O)OCOCC2CC2)c1Br |
| InChI | InChI=1S/C12H14BrNO3/c13-11-9(2-1-3-10(11)14)12(15)17-7-16-6-8-4-5-8/h1-3,8H,4-7,14H2 |
| InChIKey | OMBPQMNTJIIQHZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze cyclopropylmethoxymethyl 3-amino-2-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropylmethoxymethyl 3-amino-2-bromobenzoate?
The IUPAC name of cyclopropylmethoxymethyl 3-amino-2-bromobenzoate (CID 106930497) is cyclopropylmethoxymethyl 3-amino-2-bromobenzoate.
What is the SMILES notation for cyclopropylmethoxymethyl 3-amino-2-bromobenzoate?
The canonical SMILES for cyclopropylmethoxymethyl 3-amino-2-bromobenzoate is Nc1cccc(C(=O)OCOCC2CC2)c1Br.
What is the InChIKey of cyclopropylmethoxymethyl 3-amino-2-bromobenzoate?
The InChIKey is OMBPQMNTJIIQHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrNO3/c13-11-9(2-1-3-10(11)14)12(15)17-7-16-6-8-4-5-8/h1-3,8H,4-7,14H2.
What are the key properties of cyclopropylmethoxymethyl 3-amino-2-bromobenzoate?
cyclopropylmethoxymethyl 3-amino-2-bromobenzoate has a molecular weight of 300.15 g/mol, XLogP of 2.57, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropylmethoxymethyl 3-amino-2-bromobenzoate is sourced from PubChem (CID 106930497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).