About 4-(4,4-dimethylpiperidin-1-yl)-N-propylpyridin-2-amine
4-(4,4-dimethylpiperidin-1-yl)-N-propylpyridin-2-amine (PubChem CID 113367796) has the molecular formula C15H25N3
and a molecular weight of 247.39 g/mol. Its IUPAC name is 4-(4,4-dimethylpiperidin-1-yl)-N-propylpyridin-2-amine.
Molecular Properties
| Compound Name | 4-(4,4-dimethylpiperidin-1-yl)-N-propylpyridin-2-amine |
| PubChem CID | 113367796 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | 4-(4,4-dimethylpiperidin-1-yl)-N-propylpyridin-2-amine |
| SMILES | CCCNc1cc(N2CCC(C)(C)CC2)ccn1 |
| InChI | InChI=1S/C15H25N3/c1-4-8-16-14-12-13(5-9-17-14)18-10-6-15(2,3)7-11-18/h5,9,12H,4,6-8,10-11H2,1-3H3,(H,16,17) |
| InChIKey | SRNQNFZDLINHAJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4,4-dimethylpiperidin-1-yl)-N-propylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,4-dimethylpiperidin-1-yl)-N-propylpyridin-2-amine?
The IUPAC name of 4-(4,4-dimethylpiperidin-1-yl)-N-propylpyridin-2-amine (CID 113367796) is 4-(4,4-dimethylpiperidin-1-yl)-N-propylpyridin-2-amine.
What is the SMILES notation for 4-(4,4-dimethylpiperidin-1-yl)-N-propylpyridin-2-amine?
The canonical SMILES for 4-(4,4-dimethylpiperidin-1-yl)-N-propylpyridin-2-amine is CCCNc1cc(N2CCC(C)(C)CC2)ccn1.
What is the InChIKey of 4-(4,4-dimethylpiperidin-1-yl)-N-propylpyridin-2-amine?
The InChIKey is SRNQNFZDLINHAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N3/c1-4-8-16-14-12-13(5-9-17-14)18-10-6-15(2,3)7-11-18/h5,9,12H,4,6-8,10-11H2,1-3H3,(H,16,17).
What are the key properties of 4-(4,4-dimethylpiperidin-1-yl)-N-propylpyridin-2-amine?
4-(4,4-dimethylpiperidin-1-yl)-N-propylpyridin-2-amine has a molecular weight of 247.39 g/mol, XLogP of 3.53, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,4-dimethylpiperidin-1-yl)-N-propylpyridin-2-amine is sourced from PubChem (CID 113367796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).