About 4-N-(2,3-dihydro-1-benzofuran-3-yl)-2-N-methylpyridine-2,4-diamine
4-N-(2,3-dihydro-1-benzofuran-3-yl)-2-N-methylpyridine-2,4-diamine (PubChem CID 113367866) has the molecular formula C14H15N3O
and a molecular weight of 241.29 g/mol. Its IUPAC name is 4-N-(2,3-dihydro-1-benzofuran-3-yl)-2-N-methylpyridine-2,4-diamine.
Molecular Properties
| Compound Name | 4-N-(2,3-dihydro-1-benzofuran-3-yl)-2-N-methylpyridine-2,4-diamine |
| PubChem CID | 113367866 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 4-N-(2,3-dihydro-1-benzofuran-3-yl)-2-N-methylpyridine-2,4-diamine |
| SMILES | CNc1cc(NC2COc3ccccc32)ccn1 |
| InChI | InChI=1S/C14H15N3O/c1-15-14-8-10(6-7-16-14)17-12-9-18-13-5-3-2-4-11(12)13/h2-8,12H,9H2,1H3,(H2,15,16,17) |
| InChIKey | JBBNXSXPDXUZFE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-N-(2,3-dihydro-1-benzofuran-3-yl)-2-N-methylpyridine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(2,3-dihydro-1-benzofuran-3-yl)-2-N-methylpyridine-2,4-diamine?
The IUPAC name of 4-N-(2,3-dihydro-1-benzofuran-3-yl)-2-N-methylpyridine-2,4-diamine (CID 113367866) is 4-N-(2,3-dihydro-1-benzofuran-3-yl)-2-N-methylpyridine-2,4-diamine.
What is the SMILES notation for 4-N-(2,3-dihydro-1-benzofuran-3-yl)-2-N-methylpyridine-2,4-diamine?
The canonical SMILES for 4-N-(2,3-dihydro-1-benzofuran-3-yl)-2-N-methylpyridine-2,4-diamine is CNc1cc(NC2COc3ccccc32)ccn1.
What is the InChIKey of 4-N-(2,3-dihydro-1-benzofuran-3-yl)-2-N-methylpyridine-2,4-diamine?
The InChIKey is JBBNXSXPDXUZFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O/c1-15-14-8-10(6-7-16-14)17-12-9-18-13-5-3-2-4-11(12)13/h2-8,12H,9H2,1H3,(H2,15,16,17).
What are the key properties of 4-N-(2,3-dihydro-1-benzofuran-3-yl)-2-N-methylpyridine-2,4-diamine?
4-N-(2,3-dihydro-1-benzofuran-3-yl)-2-N-methylpyridine-2,4-diamine has a molecular weight of 241.29 g/mol, XLogP of 2.67, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(2,3-dihydro-1-benzofuran-3-yl)-2-N-methylpyridine-2,4-diamine is sourced from PubChem (CID 113367866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).