About 4-[(2-bromo-3-fluorophenyl)methoxy]-2,6-dimethyloxane
4-[(2-bromo-3-fluorophenyl)methoxy]-2,6-dimethyloxane (PubChem CID 113369277) has the molecular formula C14H18BrFO2
and a molecular weight of 317.20 g/mol. Its IUPAC name is 4-[(2-bromo-3-fluorophenyl)methoxy]-2,6-dimethyloxane.
Molecular Properties
| Compound Name | 4-[(2-bromo-3-fluorophenyl)methoxy]-2,6-dimethyloxane |
| PubChem CID | 113369277 |
| Molecular Formula | C14H18BrFO2 |
| Molecular Weight | 317.20 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 4-[(2-bromo-3-fluorophenyl)methoxy]-2,6-dimethyloxane |
| SMILES | CC1CC(OCc2cccc(F)c2Br)CC(C)O1 |
| InChI | InChI=1S/C14H18BrFO2/c1-9-6-12(7-10(2)18-9)17-8-11-4-3-5-13(16)14(11)15/h3-5,9-10,12H,6-8H2,1-2H3 |
| InChIKey | CUEJUZGKUNDJJL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.20 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(2-bromo-3-fluorophenyl)methoxy]-2,6-dimethyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-bromo-3-fluorophenyl)methoxy]-2,6-dimethyloxane?
The IUPAC name of 4-[(2-bromo-3-fluorophenyl)methoxy]-2,6-dimethyloxane (CID 113369277) is 4-[(2-bromo-3-fluorophenyl)methoxy]-2,6-dimethyloxane.
What is the SMILES notation for 4-[(2-bromo-3-fluorophenyl)methoxy]-2,6-dimethyloxane?
The canonical SMILES for 4-[(2-bromo-3-fluorophenyl)methoxy]-2,6-dimethyloxane is CC1CC(OCc2cccc(F)c2Br)CC(C)O1.
What is the InChIKey of 4-[(2-bromo-3-fluorophenyl)methoxy]-2,6-dimethyloxane?
The InChIKey is CUEJUZGKUNDJJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18BrFO2/c1-9-6-12(7-10(2)18-9)17-8-11-4-3-5-13(16)14(11)15/h3-5,9-10,12H,6-8H2,1-2H3.
What are the key properties of 4-[(2-bromo-3-fluorophenyl)methoxy]-2,6-dimethyloxane?
4-[(2-bromo-3-fluorophenyl)methoxy]-2,6-dimethyloxane has a molecular weight of 317.20 g/mol, XLogP of 4.06, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-bromo-3-fluorophenyl)methoxy]-2,6-dimethyloxane is sourced from PubChem (CID 113369277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).