C14H18BrFO2 — CID 113369277
4-[(2-bromo-3-fluorophenyl)methoxy]-2,6-dimethyloxane (PubChem CID 113369277) has the molecular formula C14H18BrFO2 and a molecular weight of 317.20 g/mol. Its IUPAC name is 4-[(2-bromo-3-fluorophenyl)methoxy]-2,6-dimethyloxane.
| Compound Name | 4-[(2-bromo-3-fluorophenyl)methoxy]-2,6-dimethyloxane |
|---|---|
| PubChem CID | 113369277 |
| Molecular Formula | C14H18BrFO2 |
| Molecular Weight | 317.20 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 4-[(2-bromo-3-fluorophenyl)methoxy]-2,6-dimethyloxane |
| SMILES | CC1CC(OCc2cccc(F)c2Br)CC(C)O1 |
| InChI | InChI=1S/C14H18BrFO2/c1-9-6-12(7-10(2)18-9)17-8-11-4-3-5-13(16)14(11)15/h3-5,9-10,12H,6-8H2,1-2H3 |
| InChIKey | CUEJUZGKUNDJJL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.20 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |