C16H19BrFNO — CID 115997800
2-(2-bromo-3-fluorophenyl)-1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethanone (PubChem CID 115997800) has the molecular formula C16H19BrFNO and a molecular weight of 340.24 g/mol. Its IUPAC name is 2-(2-bromo-3-fluorophenyl)-1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethanone.
| Compound Name | 2-(2-bromo-3-fluorophenyl)-1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethanone |
|---|---|
| PubChem CID | 115997800 |
| Molecular Formula | C16H19BrFNO |
| Molecular Weight | 340.24 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 2-(2-bromo-3-fluorophenyl)-1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethanone |
| SMILES | CN1C2CCC1CC(C(=O)Cc1cccc(F)c1Br)C2 |
| InChI | InChI=1S/C16H19BrFNO/c1-19-12-5-6-13(19)8-11(7-12)15(20)9-10-3-2-4-14(18)16(10)17/h2-4,11-13H,5-9H2,1H3 |
| InChIKey | SGNBTGRMWAFOQT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.24 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |