C17H21F2NO2 — CID 171949110
2-[2-(difluoromethoxy)phenyl]-1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethanone (PubChem CID 171949110) has the molecular formula C17H21F2NO2 and a molecular weight of 309.36 g/mol. Its IUPAC name is 2-[2-(difluoromethoxy)phenyl]-1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethanone.
| Compound Name | 2-[2-(difluoromethoxy)phenyl]-1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethanone |
|---|---|
| PubChem CID | 171949110 |
| Molecular Formula | C17H21F2NO2 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 2-[2-(difluoromethoxy)phenyl]-1-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)ethanone |
| SMILES | CN1C2CCC1CC(C(=O)Cc1ccccc1OC(F)F)C2 |
| InChI | InChI=1S/C17H21F2NO2/c1-20-13-6-7-14(20)9-12(8-13)15(21)10-11-4-2-3-5-16(11)22-17(18)19/h2-5,12-14,17H,6-10H2,1H3 |
| InChIKey | LHWWTVATKUMHIG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |