C13H13Cl2NS2 — CID 113369420
2-[(4-chlorophenyl)sulfanylmethyl]-4-(3-chloropropyl)-1,3-thiazole (PubChem CID 113369420) has the molecular formula C13H13Cl2NS2 and a molecular weight of 318.29 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfanylmethyl]-4-(3-chloropropyl)-1,3-thiazole.
| Compound Name | 2-[(4-chlorophenyl)sulfanylmethyl]-4-(3-chloropropyl)-1,3-thiazole |
|---|---|
| PubChem CID | 113369420 |
| Molecular Formula | C13H13Cl2NS2 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 316.99 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfanylmethyl]-4-(3-chloropropyl)-1,3-thiazole |
| SMILES | ClCCCc1csc(CSc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C13H13Cl2NS2/c14-7-1-2-11-8-18-13(16-11)9-17-12-5-3-10(15)4-6-12/h3-6,8H,1-2,7,9H2 |
| InChIKey | XWJRYWQPRWSTBS-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|