C13H12Cl3NS — CID 113369403
4-(3-chloropropyl)-2-[(3,4-dichlorophenyl)methyl]-1,3-thiazole (PubChem CID 113369403) has the molecular formula C13H12Cl3NS and a molecular weight of 320.67 g/mol. Its IUPAC name is 4-(3-chloropropyl)-2-[(3,4-dichlorophenyl)methyl]-1,3-thiazole.
| Compound Name | 4-(3-chloropropyl)-2-[(3,4-dichlorophenyl)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 113369403 |
| Molecular Formula | C13H12Cl3NS |
| Molecular Weight | 320.67 g/mol |
| Exact Mass | 318.98 |
| IUPAC Name | 4-(3-chloropropyl)-2-[(3,4-dichlorophenyl)methyl]-1,3-thiazole |
| SMILES | ClCCCc1csc(Cc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C13H12Cl3NS/c14-5-1-2-10-8-18-13(17-10)7-9-3-4-11(15)12(16)6-9/h3-4,6,8H,1-2,5,7H2 |
| InChIKey | ZXQCXPLZMOTVMP-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.67 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|