C17H22Cl2N2S — CID 91633877
N-[[2-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-4-yl]methyl]-N-methylpentan-1-amine (PubChem CID 91633877) has the molecular formula C17H22Cl2N2S and a molecular weight of 357.35 g/mol. Its IUPAC name is N-[[2-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-4-yl]methyl]-N-methylpentan-1-amine.
| Compound Name | N-[[2-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-4-yl]methyl]-N-methylpentan-1-amine |
|---|---|
| PubChem CID | 91633877 |
| Molecular Formula | C17H22Cl2N2S |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | N-[[2-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-4-yl]methyl]-N-methylpentan-1-amine |
| SMILES | CCCCCN(C)Cc1csc(Cc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C17H22Cl2N2S/c1-3-4-5-8-21(2)11-14-12-22-17(20-14)10-13-6-7-15(18)16(19)9-13/h6-7,9,12H,3-5,8,10-11H2,1-2H3 |
| InChIKey | KVXMDLUNQMKYBU-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|