C17H38O3Si2 — CID 11336946
(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-triethylsilyloxypentanal (PubChem CID 11336946) has the molecular formula C17H38O3Si2 and a molecular weight of 346.66 g/mol. Its IUPAC name is (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-triethylsilyloxypentanal.
| Compound Name | (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-triethylsilyloxypentanal |
|---|---|
| PubChem CID | 11336946 |
| Molecular Formula | C17H38O3Si2 |
| Molecular Weight | 346.66 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-triethylsilyloxypentanal |
| SMILES | CC[Si](CC)(CC)O[C@H](CC=O)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H38O3Si2/c1-10-22(11-2,12-3)20-16(13-14-18)15(4)19-21(8,9)17(5,6)7/h14-16H,10-13H2,1-9H3/t15-,16+/m0/s1 |
| InChIKey | MCRUKIBTQHEOJV-JKSUJKDBSA-N |
| XLogP | 5.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.66 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|