C13H23NO3S — CID 113369715
ethyl 2,2-dimethyl-4-[methyl(thiolan-3-yl)amino]-3-oxobutanoate (PubChem CID 113369715) has the molecular formula C13H23NO3S and a molecular weight of 273.40 g/mol. Its IUPAC name is ethyl 2,2-dimethyl-4-[methyl(thiolan-3-yl)amino]-3-oxobutanoate.
| Compound Name | ethyl 2,2-dimethyl-4-[methyl(thiolan-3-yl)amino]-3-oxobutanoate |
|---|---|
| PubChem CID | 113369715 |
| Molecular Formula | C13H23NO3S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | ethyl 2,2-dimethyl-4-[methyl(thiolan-3-yl)amino]-3-oxobutanoate |
| SMILES | CCOC(=O)C(C)(C)C(=O)CN(C)C1CCSC1 |
| InChI | InChI=1S/C13H23NO3S/c1-5-17-12(16)13(2,3)11(15)8-14(4)10-6-7-18-9-10/h10H,5-9H2,1-4H3 |
| InChIKey | AIKBWTWJYLTDNB-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|