C14H25NO4 — CID 102864575
ethyl 4-[cyclobutyl(2-hydroxyethyl)amino]-2,2-dimethyl-3-oxobutanoate (PubChem CID 102864575) has the molecular formula C14H25NO4 and a molecular weight of 271.36 g/mol. Its IUPAC name is ethyl 4-[cyclobutyl(2-hydroxyethyl)amino]-2,2-dimethyl-3-oxobutanoate.
| Compound Name | ethyl 4-[cyclobutyl(2-hydroxyethyl)amino]-2,2-dimethyl-3-oxobutanoate |
|---|---|
| PubChem CID | 102864575 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | ethyl 4-[cyclobutyl(2-hydroxyethyl)amino]-2,2-dimethyl-3-oxobutanoate |
| SMILES | CCOC(=O)C(C)(C)C(=O)CN(CCO)C1CCC1 |
| InChI | InChI=1S/C14H25NO4/c1-4-19-13(18)14(2,3)12(17)10-15(8-9-16)11-6-5-7-11/h11,16H,4-10H2,1-3H3 |
| InChIKey | CZTXHTOTPQGKJC-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|