C12H19N3O3S — CID 113369858
ethyl 4-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2,2-dimethyl-3-oxobutanoate (PubChem CID 113369858) has the molecular formula C12H19N3O3S and a molecular weight of 285.37 g/mol. Its IUPAC name is ethyl 4-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2,2-dimethyl-3-oxobutanoate.
| Compound Name | ethyl 4-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2,2-dimethyl-3-oxobutanoate |
|---|---|
| PubChem CID | 113369858 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | ethyl 4-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2,2-dimethyl-3-oxobutanoate |
| SMILES | CCOC(=O)C(C)(C)C(=O)CSc1nnc(C)n1C |
| InChI | InChI=1S/C12H19N3O3S/c1-6-18-10(17)12(3,4)9(16)7-19-11-14-13-8(2)15(11)5/h6-7H2,1-5H3 |
| InChIKey | AXEKWBXSOWPOEU-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|