C12H14N2O2S — CID 113370181
1-(2-amino-1,3-thiazol-5-yl)-1-(2-methoxyphenyl)ethanol (PubChem CID 113370181) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is 1-(2-amino-1,3-thiazol-5-yl)-1-(2-methoxyphenyl)ethanol.
| Compound Name | 1-(2-amino-1,3-thiazol-5-yl)-1-(2-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 113370181 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 1-(2-amino-1,3-thiazol-5-yl)-1-(2-methoxyphenyl)ethanol |
| SMILES | COc1ccccc1C(C)(O)c1cnc(N)s1 |
| InChI | InChI=1S/C12H14N2O2S/c1-12(15,10-7-14-11(13)17-10)8-5-3-4-6-9(8)16-2/h3-7,15H,1-2H3,(H2,13,14) |
| InChIKey | XUJMFKCRNYKHSA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |