C13H21N3O2 — CID 113371049
N-[(4S)-4-methoxypyrrolidin-3-yl]-3-propoxypyridin-2-amine (PubChem CID 113371049) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is N-[(4S)-4-methoxypyrrolidin-3-yl]-3-propoxypyridin-2-amine.
| Compound Name | N-[(4S)-4-methoxypyrrolidin-3-yl]-3-propoxypyridin-2-amine |
|---|---|
| PubChem CID | 113371049 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | N-[(4S)-4-methoxypyrrolidin-3-yl]-3-propoxypyridin-2-amine |
| SMILES | CCCOc1cccnc1NC1CNC[C@@H]1OC |
| InChI | InChI=1S/C13H21N3O2/c1-3-7-18-11-5-4-6-15-13(11)16-10-8-14-9-12(10)17-2/h4-6,10,12,14H,3,7-9H2,1-2H3,(H,15,16)/t10?,12-/m0/s1 |
| InChIKey | WKVZAXLETKJJFN-KFJBMODSSA-N |
| XLogP | 1.27 |
| TPSA | 55.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |