C14H23N3O — CID 113371376
N-[(2-aminocyclopentyl)methyl]-3-propoxypyridin-2-amine (PubChem CID 113371376) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is N-[(2-aminocyclopentyl)methyl]-3-propoxypyridin-2-amine.
| Compound Name | N-[(2-aminocyclopentyl)methyl]-3-propoxypyridin-2-amine |
|---|---|
| PubChem CID | 113371376 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | N-[(2-aminocyclopentyl)methyl]-3-propoxypyridin-2-amine |
| SMILES | CCCOc1cccnc1NCC1CCCC1N |
| InChI | InChI=1S/C14H23N3O/c1-2-9-18-13-7-4-8-16-14(13)17-10-11-5-3-6-12(11)15/h4,7-8,11-12H,2-3,5-6,9-10,15H2,1H3,(H,16,17) |
| InChIKey | XRLJHVAFDVRGQG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |