C14H17N3O — CID 113371369
N-(3-methoxy-2-pyridinyl)-1-phenylethane-1,2-diamine (PubChem CID 113371369) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is N-(3-methoxy-2-pyridinyl)-1-phenylethane-1,2-diamine.
| Compound Name | N-(3-methoxy-2-pyridinyl)-1-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 113371369 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | N-(3-methoxy-2-pyridinyl)-1-phenylethane-1,2-diamine |
| SMILES | COc1cccnc1NC(CN)c1ccccc1 |
| InChI | InChI=1S/C14H17N3O/c1-18-13-8-5-9-16-14(13)17-12(10-15)11-6-3-2-4-7-11/h2-9,12H,10,15H2,1H3,(H,16,17) |
| InChIKey | LWRZHOOLTFQRCA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |