C12H16N4S — CID 113373108
N-ethyl-6-propan-2-yl-2-(1,3-thiazol-2-yl)pyrimidin-4-amine (PubChem CID 113373108) has the molecular formula C12H16N4S and a molecular weight of 248.35 g/mol. Its IUPAC name is N-ethyl-6-propan-2-yl-2-(1,3-thiazol-2-yl)pyrimidin-4-amine.
| Compound Name | N-ethyl-6-propan-2-yl-2-(1,3-thiazol-2-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 113373108 |
| Molecular Formula | C12H16N4S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | N-ethyl-6-propan-2-yl-2-(1,3-thiazol-2-yl)pyrimidin-4-amine |
| SMILES | CCNc1cc(C(C)C)nc(-c2nccs2)n1 |
| InChI | InChI=1S/C12H16N4S/c1-4-13-10-7-9(8(2)3)15-11(16-10)12-14-5-6-17-12/h5-8H,4H2,1-3H3,(H,13,15,16) |
| InChIKey | KIZSFEZSLXYPDL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |