C14H25N3S — CID 113373157
N-[[1-methyl-2-(1,3-thiazol-5-yl)azepan-3-yl]methyl]propan-1-amine (PubChem CID 113373157) has the molecular formula C14H25N3S and a molecular weight of 267.44 g/mol. Its IUPAC name is N-[[1-methyl-2-(1,3-thiazol-5-yl)azepan-3-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-methyl-2-(1,3-thiazol-5-yl)azepan-3-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 113373157 |
| Molecular Formula | C14H25N3S |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | N-[[1-methyl-2-(1,3-thiazol-5-yl)azepan-3-yl]methyl]propan-1-amine |
| SMILES | CCCNCC1CCCCN(C)C1c1cncs1 |
| InChI | InChI=1S/C14H25N3S/c1-3-7-15-9-12-6-4-5-8-17(2)14(12)13-10-16-11-18-13/h10-12,14-15H,3-9H2,1-2H3 |
| InChIKey | WTOSIQIRVOAHCO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|