C13H21BrN2S — CID 115381366
N-[[2-(3-bromothiophen-2-yl)-1-methylpyrrolidin-3-yl]methyl]propan-1-amine (PubChem CID 115381366) has the molecular formula C13H21BrN2S and a molecular weight of 317.30 g/mol. Its IUPAC name is N-[[2-(3-bromothiophen-2-yl)-1-methylpyrrolidin-3-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-(3-bromothiophen-2-yl)-1-methylpyrrolidin-3-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 115381366 |
| Molecular Formula | C13H21BrN2S |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | N-[[2-(3-bromothiophen-2-yl)-1-methylpyrrolidin-3-yl]methyl]propan-1-amine |
| SMILES | CCCNCC1CCN(C)C1c1sccc1Br |
| InChI | InChI=1S/C13H21BrN2S/c1-3-6-15-9-10-4-7-16(2)12(10)13-11(14)5-8-17-13/h5,8,10,12,15H,3-4,6-7,9H2,1-2H3 |
| InChIKey | QHTNOBFSIFGUMC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|