C10H4ClF3N2O2 — CID 113373696
5-chloro-1-(3,4,5-trifluorophenyl)pyrazole-4-carboxylic acid (PubChem CID 113373696) has the molecular formula C10H4ClF3N2O2 and a molecular weight of 276.60 g/mol. Its IUPAC name is 5-chloro-1-(3,4,5-trifluorophenyl)pyrazole-4-carboxylic acid.
| Compound Name | 5-chloro-1-(3,4,5-trifluorophenyl)pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 113373696 |
| Molecular Formula | C10H4ClF3N2O2 |
| Molecular Weight | 276.60 g/mol |
| Exact Mass | 275.99 |
| IUPAC Name | 5-chloro-1-(3,4,5-trifluorophenyl)pyrazole-4-carboxylic acid |
| SMILES | O=C(O)c1cnn(-c2cc(F)c(F)c(F)c2)c1Cl |
| InChI | InChI=1S/C10H4ClF3N2O2/c11-9-5(10(17)18)3-15-16(9)4-1-6(12)8(14)7(13)2-4/h1-3H,(H,17,18) |
| InChIKey | WWCZKPLBFMQBTR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.60 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|