5-chloro-1-(3,4,5-trifluorophenyl)pyrazole-4-carboxylic acid

C10H4ClF3N2O2 — CID 113373696

IUPAC5-chloro-1-(3,4,5-trifluorophenyl)pyrazole-4-carboxylic acid
SMILESO=C(O)c1cnn(-c2cc(F)c(F)c(F)c2)c1Cl
InChIInChI=1S/C10H4ClF3N2O2/c11-9-5(10(17)18)3-15-16(9)4-1-6(12)8(14)7(13)2-4/h1-3H,(H,17,18)
InChIKeyWWCZKPLBFMQBTR-UHFFFAOYSA-N
MW276.60 g/mol
LogP2.64
Rot. Bonds2

About 5-chloro-1-(3,4,5-trifluorophenyl)pyrazole-4-carboxylic acid

5-chloro-1-(3,4,5-trifluorophenyl)pyrazole-4-carboxylic acid (PubChem CID 113373696) has the molecular formula C10H4ClF3N2O2 and a molecular weight of 276.60 g/mol. Its IUPAC name is 5-chloro-1-(3,4,5-trifluorophenyl)pyrazole-4-carboxylic acid.

Molecular Properties

Compound Name5-chloro-1-(3,4,5-trifluorophenyl)pyrazole-4-carboxylic acid
PubChem CID113373696
Molecular FormulaC10H4ClF3N2O2
Molecular Weight276.60 g/mol
Exact Mass275.99
IUPAC Name5-chloro-1-(3,4,5-trifluorophenyl)pyrazole-4-carboxylic acid
SMILESO=C(O)c1cnn(-c2cc(F)c(F)c(F)c2)c1Cl
InChIInChI=1S/C10H4ClF3N2O2/c11-9-5(10(17)18)3-15-16(9)4-1-6(12)8(14)7(13)2-4/h1-3H,(H,17,18)
InChIKeyWWCZKPLBFMQBTR-UHFFFAOYSA-N
XLogP2.64
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.60
LogP ≤ 52.64
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}

Analyze 5-chloro-1-(3,4,5-trifluorophenyl)pyrazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-chloro-1-(3,4,5-trifluorophenyl)pyrazole-4-carboxylic acid?
The IUPAC name of 5-chloro-1-(3,4,5-trifluorophenyl)pyrazole-4-carboxylic acid (CID 113373696) is 5-chloro-1-(3,4,5-trifluorophenyl)pyrazole-4-carboxylic acid.
What is the SMILES notation for 5-chloro-1-(3,4,5-trifluorophenyl)pyrazole-4-carboxylic acid?
The canonical SMILES for 5-chloro-1-(3,4,5-trifluorophenyl)pyrazole-4-carboxylic acid is O=C(O)c1cnn(-c2cc(F)c(F)c(F)c2)c1Cl.
What is the InChIKey of 5-chloro-1-(3,4,5-trifluorophenyl)pyrazole-4-carboxylic acid?
The InChIKey is WWCZKPLBFMQBTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H4ClF3N2O2/c11-9-5(10(17)18)3-15-16(9)4-1-6(12)8(14)7(13)2-4/h1-3H,(H,17,18).
What are the key properties of 5-chloro-1-(3,4,5-trifluorophenyl)pyrazole-4-carboxylic acid?
5-chloro-1-(3,4,5-trifluorophenyl)pyrazole-4-carboxylic acid has a molecular weight of 276.60 g/mol, XLogP of 2.64, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1-(3,4,5-trifluorophenyl)pyrazole-4-carboxylic acid is sourced from PubChem (CID 113373696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).