C10H6F5N3 — CID 79200172
5-(difluoromethyl)-1-(3,4,5-trifluorophenyl)pyrazol-4-amine (PubChem CID 79200172) has the molecular formula C10H6F5N3 and a molecular weight of 263.17 g/mol. Its IUPAC name is 5-(difluoromethyl)-1-(3,4,5-trifluorophenyl)pyrazol-4-amine.
| Compound Name | 5-(difluoromethyl)-1-(3,4,5-trifluorophenyl)pyrazol-4-amine |
|---|---|
| PubChem CID | 79200172 |
| Molecular Formula | C10H6F5N3 |
| Molecular Weight | 263.17 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 5-(difluoromethyl)-1-(3,4,5-trifluorophenyl)pyrazol-4-amine |
| SMILES | Nc1cnn(-c2cc(F)c(F)c(F)c2)c1C(F)F |
| InChI | InChI=1S/C10H6F5N3/c11-5-1-4(2-6(12)8(5)13)18-9(10(14)15)7(16)3-17-18/h1-3,10H,16H2 |
| InChIKey | SPVWOPWSFAZXBD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.17 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|