About [5-ethyl-1-(3,4,5-trifluorophenyl)pyrazol-4-yl]methanol
[5-ethyl-1-(3,4,5-trifluorophenyl)pyrazol-4-yl]methanol (PubChem CID 79200351) has the molecular formula C12H11F3N2O
and a molecular weight of 256.23 g/mol. Its IUPAC name is [5-ethyl-1-(3,4,5-trifluorophenyl)pyrazol-4-yl]methanol.
Molecular Properties
| Compound Name | [5-ethyl-1-(3,4,5-trifluorophenyl)pyrazol-4-yl]methanol |
| PubChem CID | 79200351 |
| Molecular Formula | C12H11F3N2O |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | [5-ethyl-1-(3,4,5-trifluorophenyl)pyrazol-4-yl]methanol |
| SMILES | CCc1c(CO)cnn1-c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C12H11F3N2O/c1-2-11-7(6-18)5-16-17(11)8-3-9(13)12(15)10(14)4-8/h3-5,18H,2,6H2,1H3 |
| InChIKey | HGWORUNASWRMRO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze [5-ethyl-1-(3,4,5-trifluorophenyl)pyrazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-ethyl-1-(3,4,5-trifluorophenyl)pyrazol-4-yl]methanol?
The IUPAC name of [5-ethyl-1-(3,4,5-trifluorophenyl)pyrazol-4-yl]methanol (CID 79200351) is [5-ethyl-1-(3,4,5-trifluorophenyl)pyrazol-4-yl]methanol.
What is the SMILES notation for [5-ethyl-1-(3,4,5-trifluorophenyl)pyrazol-4-yl]methanol?
The canonical SMILES for [5-ethyl-1-(3,4,5-trifluorophenyl)pyrazol-4-yl]methanol is CCc1c(CO)cnn1-c1cc(F)c(F)c(F)c1.
What is the InChIKey of [5-ethyl-1-(3,4,5-trifluorophenyl)pyrazol-4-yl]methanol?
The InChIKey is HGWORUNASWRMRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11F3N2O/c1-2-11-7(6-18)5-16-17(11)8-3-9(13)12(15)10(14)4-8/h3-5,18H,2,6H2,1H3.
What are the key properties of [5-ethyl-1-(3,4,5-trifluorophenyl)pyrazol-4-yl]methanol?
[5-ethyl-1-(3,4,5-trifluorophenyl)pyrazol-4-yl]methanol has a molecular weight of 256.23 g/mol, XLogP of 2.34, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-ethyl-1-(3,4,5-trifluorophenyl)pyrazol-4-yl]methanol is sourced from PubChem (CID 79200351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).