C16H20O2 — CID 113374244
7-methoxy-2-pent-4-ynyl-3,4-dihydro-1H-naphthalen-2-ol (PubChem CID 113374244) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is 7-methoxy-2-pent-4-ynyl-3,4-dihydro-1H-naphthalen-2-ol.
| Compound Name | 7-methoxy-2-pent-4-ynyl-3,4-dihydro-1H-naphthalen-2-ol |
|---|---|
| PubChem CID | 113374244 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | 7-methoxy-2-pent-4-ynyl-3,4-dihydro-1H-naphthalen-2-ol |
| SMILES | C#CCCCC1(O)CCc2ccc(OC)cc2C1 |
| InChI | InChI=1S/C16H20O2/c1-3-4-5-9-16(17)10-8-13-6-7-15(18-2)11-14(13)12-16/h1,6-7,11,17H,4-5,8-10,12H2,2H3 |
| InChIKey | AENFFHSNJAGAOJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|