C14H19NO3 — CID 113375601
(4-butoxyphenyl)-(1,2-oxazolidin-2-yl)methanone (PubChem CID 113375601) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is (4-butoxyphenyl)-(1,2-oxazolidin-2-yl)methanone.
| Compound Name | (4-butoxyphenyl)-(1,2-oxazolidin-2-yl)methanone |
|---|---|
| PubChem CID | 113375601 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | (4-butoxyphenyl)-(1,2-oxazolidin-2-yl)methanone |
| SMILES | CCCCOc1ccc(C(=O)N2CCCO2)cc1 |
| InChI | InChI=1S/C14H19NO3/c1-2-3-10-17-13-7-5-12(6-8-13)14(16)15-9-4-11-18-15/h5-8H,2-4,9-11H2,1H3 |
| InChIKey | CJRNWPJIDUNHRA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|