C17H26N2O2 — CID 63910772
(4-butoxyphenyl)-(2,6-dimethylpiperazin-1-yl)methanone (PubChem CID 63910772) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is (4-butoxyphenyl)-(2,6-dimethylpiperazin-1-yl)methanone.
| Compound Name | (4-butoxyphenyl)-(2,6-dimethylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 63910772 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | (4-butoxyphenyl)-(2,6-dimethylpiperazin-1-yl)methanone |
| SMILES | CCCCOc1ccc(C(=O)N2C(C)CNCC2C)cc1 |
| InChI | InChI=1S/C17H26N2O2/c1-4-5-10-21-16-8-6-15(7-9-16)17(20)19-13(2)11-18-12-14(19)3/h6-9,13-14,18H,4-5,10-12H2,1-3H3 |
| InChIKey | KOJMEUNZRCQDDR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|