C15H28ClNO — CID 113376732
N-(4-chloropentan-2-yl)-1-(2-methylpropyl)cyclopentane-1-carboxamide (PubChem CID 113376732) has the molecular formula C15H28ClNO and a molecular weight of 273.85 g/mol. Its IUPAC name is N-(4-chloropentan-2-yl)-1-(2-methylpropyl)cyclopentane-1-carboxamide.
| Compound Name | N-(4-chloropentan-2-yl)-1-(2-methylpropyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 113376732 |
| Molecular Formula | C15H28ClNO |
| Molecular Weight | 273.85 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | N-(4-chloropentan-2-yl)-1-(2-methylpropyl)cyclopentane-1-carboxamide |
| SMILES | CC(C)CC1(C(=O)NC(C)CC(C)Cl)CCCC1 |
| InChI | InChI=1S/C15H28ClNO/c1-11(2)10-15(7-5-6-8-15)14(18)17-13(4)9-12(3)16/h11-13H,5-10H2,1-4H3,(H,17,18) |
| InChIKey | YTXOVHPCDLDEEP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.85 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|