C14H23NO — CID 114390037
N-but-3-yn-2-yl-1-(2-methylpropyl)cyclopentane-1-carboxamide (PubChem CID 114390037) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is N-but-3-yn-2-yl-1-(2-methylpropyl)cyclopentane-1-carboxamide.
| Compound Name | N-but-3-yn-2-yl-1-(2-methylpropyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 114390037 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | N-but-3-yn-2-yl-1-(2-methylpropyl)cyclopentane-1-carboxamide |
| SMILES | C#CC(C)NC(=O)C1(CC(C)C)CCCC1 |
| InChI | InChI=1S/C14H23NO/c1-5-12(4)15-13(16)14(10-11(2)3)8-6-7-9-14/h1,11-12H,6-10H2,2-4H3,(H,15,16) |
| InChIKey | GUYOMGZEYBZYPW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|