C20H20N2O6 — CID 11338084
(4S)-4-benzyl-3-[(2R,3S)-3-hydroxy-2-methyl-3-(4-nitrophenyl)propanoyl]-1,3-oxazolidin-2-one (PubChem CID 11338084) has the molecular formula C20H20N2O6 and a molecular weight of 384.39 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(2R,3S)-3-hydroxy-2-methyl-3-(4-nitrophenyl)propanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(2R,3S)-3-hydroxy-2-methyl-3-(4-nitrophenyl)propanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11338084 |
| Molecular Formula | C20H20N2O6 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | (4S)-4-benzyl-3-[(2R,3S)-3-hydroxy-2-methyl-3-(4-nitrophenyl)propanoyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@@H](C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)[C@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H20N2O6/c1-13(18(23)15-7-9-16(10-8-15)22(26)27)19(24)21-17(12-28-20(21)25)11-14-5-3-2-4-6-14/h2-10,13,17-18,23H,11-12H2,1H3/t13-,17+,18+/m1/s1 |
| InChIKey | LEHHVZVXRZBCGZ-BVGQSLNGSA-N |
| XLogP | 2.85 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|