C14H25N3 — CID 113381451
6-tert-butyl-4-[(2-methylpropylamino)methyl]pyridin-2-amine (PubChem CID 113381451) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is 6-tert-butyl-4-[(2-methylpropylamino)methyl]pyridin-2-amine.
| Compound Name | 6-tert-butyl-4-[(2-methylpropylamino)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 113381451 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | 6-tert-butyl-4-[(2-methylpropylamino)methyl]pyridin-2-amine |
| SMILES | CC(C)CNCc1cc(N)nc(C(C)(C)C)c1 |
| InChI | InChI=1S/C14H25N3/c1-10(2)8-16-9-11-6-12(14(3,4)5)17-13(15)7-11/h6-7,10,16H,8-9H2,1-5H3,(H2,15,17) |
| InChIKey | ORHKRHOUHBKQNF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |