C13H19N3O2 — CID 113388399
(E)-3-[2-(dipropylamino)pyrimidin-5-yl]prop-2-enoic acid (PubChem CID 113388399) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is (E)-3-[2-(dipropylamino)pyrimidin-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(dipropylamino)pyrimidin-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 113388399 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | (E)-3-[2-(dipropylamino)pyrimidin-5-yl]prop-2-enoic acid |
| SMILES | CCCN(CCC)c1ncc(/C=C/C(=O)O)cn1 |
| InChI | InChI=1S/C13H19N3O2/c1-3-7-16(8-4-2)13-14-9-11(10-15-13)5-6-12(17)18/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,17,18)/b6-5+ |
| InChIKey | DQQXPISZXDGBHM-AATRIKPKSA-N |
| XLogP | 2.20 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|