C13H16N4O2 — CID 113388417
(E)-3-[2-[2-cyanopropyl(ethyl)amino]pyrimidin-5-yl]prop-2-enoic acid (PubChem CID 113388417) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is (E)-3-[2-[2-cyanopropyl(ethyl)amino]pyrimidin-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[2-cyanopropyl(ethyl)amino]pyrimidin-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 113388417 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | (E)-3-[2-[2-cyanopropyl(ethyl)amino]pyrimidin-5-yl]prop-2-enoic acid |
| SMILES | CCN(CC(C)C#N)c1ncc(/C=C/C(=O)O)cn1 |
| InChI | InChI=1S/C13H16N4O2/c1-3-17(9-10(2)6-14)13-15-7-11(8-16-13)4-5-12(18)19/h4-5,7-8,10H,3,9H2,1-2H3,(H,18,19)/b5-4+ |
| InChIKey | BTOKMEOSQPLNBG-SNAWJCMRSA-N |
| XLogP | 1.56 |
| TPSA | 90.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|