C14H15N3O3 — CID 76988422
3-[6-[1-cyanopropan-2-yl(methyl)carbamoyl]-3-pyridinyl]prop-2-enoic acid (PubChem CID 76988422) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is 3-[6-[1-cyanopropan-2-yl(methyl)carbamoyl]-3-pyridinyl]prop-2-enoic acid.
| Compound Name | 3-[6-[1-cyanopropan-2-yl(methyl)carbamoyl]-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76988422 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 3-[6-[1-cyanopropan-2-yl(methyl)carbamoyl]-3-pyridinyl]prop-2-enoic acid |
| SMILES | CC(CC#N)N(C)C(=O)c1ccc(C=CC(=O)O)cn1 |
| InChI | InChI=1S/C14H15N3O3/c1-10(7-8-15)17(2)14(20)12-5-3-11(9-16-12)4-6-13(18)19/h3-6,9-10H,7H2,1-2H3,(H,18,19) |
| InChIKey | AJFCGQMZBHAHLN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 94.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|