C13H16N2O5S — CID 79846152
3-[6-[methyl(2-methylsulfonylethyl)carbamoyl]-3-pyridinyl]prop-2-enoic acid (PubChem CID 79846152) has the molecular formula C13H16N2O5S and a molecular weight of 312.35 g/mol. Its IUPAC name is 3-[6-[methyl(2-methylsulfonylethyl)carbamoyl]-3-pyridinyl]prop-2-enoic acid.
| Compound Name | 3-[6-[methyl(2-methylsulfonylethyl)carbamoyl]-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 79846152 |
| Molecular Formula | C13H16N2O5S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 3-[6-[methyl(2-methylsulfonylethyl)carbamoyl]-3-pyridinyl]prop-2-enoic acid |
| SMILES | CN(CCS(C)(=O)=O)C(=O)c1ccc(C=CC(=O)O)cn1 |
| InChI | InChI=1S/C13H16N2O5S/c1-15(7-8-21(2,19)20)13(18)11-5-3-10(9-14-11)4-6-12(16)17/h3-6,9H,7-8H2,1-2H3,(H,16,17) |
| InChIKey | BPVTYKMGYJUGQR-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|