C11H15N3O3S2 — CID 79859087
5-carbamothioyl-N-methyl-N-(2-methylsulfonylethyl)pyridine-2-carboxamide (PubChem CID 79859087) has the molecular formula C11H15N3O3S2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 5-carbamothioyl-N-methyl-N-(2-methylsulfonylethyl)pyridine-2-carboxamide.
| Compound Name | 5-carbamothioyl-N-methyl-N-(2-methylsulfonylethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 79859087 |
| Molecular Formula | C11H15N3O3S2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 5-carbamothioyl-N-methyl-N-(2-methylsulfonylethyl)pyridine-2-carboxamide |
| SMILES | CN(CCS(C)(=O)=O)C(=O)c1ccc(C(N)=S)cn1 |
| InChI | InChI=1S/C11H15N3O3S2/c1-14(5-6-19(2,16)17)11(15)9-4-3-8(7-13-9)10(12)18/h3-4,7H,5-6H2,1-2H3,(H2,12,18) |
| InChIKey | GQZJRIUXBLAGDM-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|