C12H15N3O3S — CID 63749737
methyl 3-[(5-carbamothioylpyridine-2-carbonyl)-methylamino]propanoate (PubChem CID 63749737) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is methyl 3-[(5-carbamothioylpyridine-2-carbonyl)-methylamino]propanoate.
| Compound Name | methyl 3-[(5-carbamothioylpyridine-2-carbonyl)-methylamino]propanoate |
|---|---|
| PubChem CID | 63749737 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | methyl 3-[(5-carbamothioylpyridine-2-carbonyl)-methylamino]propanoate |
| SMILES | COC(=O)CCN(C)C(=O)c1ccc(C(N)=S)cn1 |
| InChI | InChI=1S/C12H15N3O3S/c1-15(6-5-10(16)18-2)12(17)9-4-3-8(7-14-9)11(13)19/h3-4,7H,5-6H2,1-2H3,(H2,13,19) |
| InChIKey | RSFDEJGHKWEDPS-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|