C11H16N4 — CID 83065176
3-[ethyl-(3-methylpyrazin-2-yl)amino]-2-methylpropanenitrile (PubChem CID 83065176) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is 3-[ethyl-(3-methylpyrazin-2-yl)amino]-2-methylpropanenitrile.
| Compound Name | 3-[ethyl-(3-methylpyrazin-2-yl)amino]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 83065176 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 3-[ethyl-(3-methylpyrazin-2-yl)amino]-2-methylpropanenitrile |
| SMILES | CCN(CC(C)C#N)c1nccnc1C |
| InChI | InChI=1S/C11H16N4/c1-4-15(8-9(2)7-12)11-10(3)13-5-6-14-11/h5-6,9H,4,8H2,1-3H3 |
| InChIKey | COHZJKYEILMGLB-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 52.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |