C10H13BrN4 — CID 66343198
3-[(5-bromopyrimidin-4-yl)-ethylamino]-2-methylpropanenitrile (PubChem CID 66343198) has the molecular formula C10H13BrN4 and a molecular weight of 269.15 g/mol. Its IUPAC name is 3-[(5-bromopyrimidin-4-yl)-ethylamino]-2-methylpropanenitrile.
| Compound Name | 3-[(5-bromopyrimidin-4-yl)-ethylamino]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 66343198 |
| Molecular Formula | C10H13BrN4 |
| Molecular Weight | 269.15 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 3-[(5-bromopyrimidin-4-yl)-ethylamino]-2-methylpropanenitrile |
| SMILES | CCN(CC(C)C#N)c1ncncc1Br |
| InChI | InChI=1S/C10H13BrN4/c1-3-15(6-8(2)4-12)10-9(11)5-13-7-14-10/h5,7-8H,3,6H2,1-2H3 |
| InChIKey | AVBPSVBAUWIUFL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 52.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.15 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |