C13H20BrN5 — CID 80806926
3-[[5-bromo-2-(propylamino)pyrimidin-4-yl]-ethylamino]-2-methylpropanenitrile (PubChem CID 80806926) has the molecular formula C13H20BrN5 and a molecular weight of 326.24 g/mol. Its IUPAC name is 3-[[5-bromo-2-(propylamino)pyrimidin-4-yl]-ethylamino]-2-methylpropanenitrile.
| Compound Name | 3-[[5-bromo-2-(propylamino)pyrimidin-4-yl]-ethylamino]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 80806926 |
| Molecular Formula | C13H20BrN5 |
| Molecular Weight | 326.24 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 3-[[5-bromo-2-(propylamino)pyrimidin-4-yl]-ethylamino]-2-methylpropanenitrile |
| SMILES | CCCNc1ncc(Br)c(N(CC)CC(C)C#N)n1 |
| InChI | InChI=1S/C13H20BrN5/c1-4-6-16-13-17-8-11(14)12(18-13)19(5-2)9-10(3)7-15/h8,10H,4-6,9H2,1-3H3,(H,16,17,18) |
| InChIKey | UZODZRLUCXHFON-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.24 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |