C10H15N5 — CID 80653025
3-[(5-aminopyrazin-2-yl)-ethylamino]-2-methylpropanenitrile (PubChem CID 80653025) has the molecular formula C10H15N5 and a molecular weight of 205.26 g/mol. Its IUPAC name is 3-[(5-aminopyrazin-2-yl)-ethylamino]-2-methylpropanenitrile.
| Compound Name | 3-[(5-aminopyrazin-2-yl)-ethylamino]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 80653025 |
| Molecular Formula | C10H15N5 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 3-[(5-aminopyrazin-2-yl)-ethylamino]-2-methylpropanenitrile |
| SMILES | CCN(CC(C)C#N)c1cnc(N)cn1 |
| InChI | InChI=1S/C10H15N5/c1-3-15(7-8(2)4-11)10-6-13-9(12)5-14-10/h5-6,8H,3,7H2,1-2H3,(H2,12,13) |
| InChIKey | HNXCEWOKUIDRGD-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 78.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |